C20H24NO4P — CID 166393763
5-(2-diphenylphosphorylethylamino)-3-methyl-5-oxopentanoic acid (PubChem CID 166393763) has the molecular formula C20H24NO4P and a molecular weight of 373.39 g/mol. Its IUPAC name is 5-(2-diphenylphosphorylethylamino)-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-(2-diphenylphosphorylethylamino)-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 166393763 |
| Molecular Formula | C20H24NO4P |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 5-(2-diphenylphosphorylethylamino)-3-methyl-5-oxopentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)NCCP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24NO4P/c1-16(15-20(23)24)14-19(22)21-12-13-26(25,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,16H,12-15H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | XOITXSFAMOMKQS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|