About (2S)-2-[[2-[[2-(6,6-dimethylmorpholin-2-yl)acetyl]amino]acetyl]amino]propanoic acid;hydrochloride
(2S)-2-[[2-[[2-(6,6-dimethylmorpholin-2-yl)acetyl]amino]acetyl]amino]propanoic acid;hydrochloride (PubChem CID 166394563) has the molecular formula C13H24ClN3O5
and a molecular weight of 337.80 g/mol. Its IUPAC name is (2S)-2-[[2-[[2-(6,6-dimethylmorpholin-2-yl)acetyl]amino]acetyl]amino]propanoic acid;hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-[[2-[[2-(6,6-dimethylmorpholin-2-yl)acetyl]amino]acetyl]amino]propanoic acid;hydrochloride |
| PubChem CID | 166394563 |
| Molecular Formula | C13H24ClN3O5 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (2S)-2-[[2-[[2-(6,6-dimethylmorpholin-2-yl)acetyl]amino]acetyl]amino]propanoic acid;hydrochloride |
| SMILES | C[C@H](NC(=O)CNC(=O)CC1CNCC(C)(C)O1)C(=O)O.Cl |
| InChI | InChI=1S/C13H23N3O5.ClH/c1-8(12(19)20)16-11(18)6-15-10(17)4-9-5-14-7-13(2,3)21-9;/h8-9,14H,4-7H2,1-3H3,(H,15,17)(H,16,18)(H,19,20);1H/t8-,9?;/m0./s1 |
| InChIKey | KNPMKVHVGURLHQ-GUORDYTPSA-N |
| XLogP | -0.73 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-[[2-[[2-(6,6-dimethylmorpholin-2-yl)acetyl]amino]acetyl]amino]propanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[2-[[2-(6,6-dimethylmorpholin-2-yl)acetyl]amino]acetyl]amino]propanoic acid;hydrochloride?
The IUPAC name of (2S)-2-[[2-[[2-(6,6-dimethylmorpholin-2-yl)acetyl]amino]acetyl]amino]propanoic acid;hydrochloride (CID 166394563) is (2S)-2-[[2-[[2-(6,6-dimethylmorpholin-2-yl)acetyl]amino]acetyl]amino]propanoic acid;hydrochloride.
What is the SMILES notation for (2S)-2-[[2-[[2-(6,6-dimethylmorpholin-2-yl)acetyl]amino]acetyl]amino]propanoic acid;hydrochloride?
The canonical SMILES for (2S)-2-[[2-[[2-(6,6-dimethylmorpholin-2-yl)acetyl]amino]acetyl]amino]propanoic acid;hydrochloride is C[C@H](NC(=O)CNC(=O)CC1CNCC(C)(C)O1)C(=O)O.Cl.
What is the InChIKey of (2S)-2-[[2-[[2-(6,6-dimethylmorpholin-2-yl)acetyl]amino]acetyl]amino]propanoic acid;hydrochloride?
The InChIKey is KNPMKVHVGURLHQ-GUORDYTPSA-N. The full InChI is InChI=1S/C13H23N3O5.ClH/c1-8(12(19)20)16-11(18)6-15-10(17)4-9-5-14-7-13(2,3)21-9;/h8-9,14H,4-7H2,1-3H3,(H,15,17)(H,16,18)(H,19,20);1H/t8-,9?;/m0./s1.
What are the key properties of (2S)-2-[[2-[[2-(6,6-dimethylmorpholin-2-yl)acetyl]amino]acetyl]amino]propanoic acid;hydrochloride?
(2S)-2-[[2-[[2-(6,6-dimethylmorpholin-2-yl)acetyl]amino]acetyl]amino]propanoic acid;hydrochloride has a molecular weight of 337.80 g/mol, XLogP of -0.73, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[2-[[2-(6,6-dimethylmorpholin-2-yl)acetyl]amino]acetyl]amino]propanoic acid;hydrochloride is sourced from PubChem (CID 166394563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).