C16H16F2N2O4S — CID 166396211
3-[(3,5-difluoro-2-hydroxyphenyl)sulfonylamino]-N,N,5-trimethylbenzamide (PubChem CID 166396211) has the molecular formula C16H16F2N2O4S and a molecular weight of 370.38 g/mol. Its IUPAC name is 3-[(3,5-difluoro-2-hydroxyphenyl)sulfonylamino]-N,N,5-trimethylbenzamide.
| Compound Name | 3-[(3,5-difluoro-2-hydroxyphenyl)sulfonylamino]-N,N,5-trimethylbenzamide |
|---|---|
| PubChem CID | 166396211 |
| Molecular Formula | C16H16F2N2O4S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 3-[(3,5-difluoro-2-hydroxyphenyl)sulfonylamino]-N,N,5-trimethylbenzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(F)cc(F)c2O)cc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C16H16F2N2O4S/c1-9-4-10(16(22)20(2)3)6-12(5-9)19-25(23,24)14-8-11(17)7-13(18)15(14)21/h4-8,19,21H,1-3H3 |
| InChIKey | VWUFDAVXNVDMDY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|