About [3-(4-hydroxyphenyl)azetidin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone
[3-(4-hydroxyphenyl)azetidin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone (PubChem CID 166397782) has the molecular formula C20H18N2O2S
and a molecular weight of 350.44 g/mol. Its IUPAC name is [3-(4-hydroxyphenyl)azetidin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone.
Molecular Properties
| Compound Name | [3-(4-hydroxyphenyl)azetidin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone |
| PubChem CID | 166397782 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | [3-(4-hydroxyphenyl)azetidin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone |
| SMILES | Cc1ccc(-c2nc(C(=O)N3CC(c4ccc(O)cc4)C3)cs2)cc1 |
| InChI | InChI=1S/C20H18N2O2S/c1-13-2-4-15(5-3-13)19-21-18(12-25-19)20(24)22-10-16(11-22)14-6-8-17(23)9-7-14/h2-9,12,16,23H,10-11H2,1H3 |
| InChIKey | ROHUZDPAGJJMQK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(4-hydroxyphenyl)azetidin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-hydroxyphenyl)azetidin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone?
The IUPAC name of [3-(4-hydroxyphenyl)azetidin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone (CID 166397782) is [3-(4-hydroxyphenyl)azetidin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone.
What is the SMILES notation for [3-(4-hydroxyphenyl)azetidin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone?
The canonical SMILES for [3-(4-hydroxyphenyl)azetidin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone is Cc1ccc(-c2nc(C(=O)N3CC(c4ccc(O)cc4)C3)cs2)cc1.
What is the InChIKey of [3-(4-hydroxyphenyl)azetidin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone?
The InChIKey is ROHUZDPAGJJMQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O2S/c1-13-2-4-15(5-3-13)19-21-18(12-25-19)20(24)22-10-16(11-22)14-6-8-17(23)9-7-14/h2-9,12,16,23H,10-11H2,1H3.
What are the key properties of [3-(4-hydroxyphenyl)azetidin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone?
[3-(4-hydroxyphenyl)azetidin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone has a molecular weight of 350.44 g/mol, XLogP of 4.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-hydroxyphenyl)azetidin-1-yl]-[2-(4-methylphenyl)-1,3-thiazol-4-yl]methanone is sourced from PubChem (CID 166397782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).