C16H16N6O — CID 166397794
6-(ethylamino)-N-(5-pyridin-2-yl-1H-pyrazol-4-yl)pyridine-3-carboxamide (PubChem CID 166397794) has the molecular formula C16H16N6O and a molecular weight of 308.35 g/mol. Its IUPAC name is 6-(ethylamino)-N-(5-pyridin-2-yl-1H-pyrazol-4-yl)pyridine-3-carboxamide.
| Compound Name | 6-(ethylamino)-N-(5-pyridin-2-yl-1H-pyrazol-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166397794 |
| Molecular Formula | C16H16N6O |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 6-(ethylamino)-N-(5-pyridin-2-yl-1H-pyrazol-4-yl)pyridine-3-carboxamide |
| SMILES | CCNc1ccc(C(=O)Nc2cn[nH]c2-c2ccccn2)cn1 |
| InChI | InChI=1S/C16H16N6O/c1-2-17-14-7-6-11(9-19-14)16(23)21-13-10-20-22-15(13)12-5-3-4-8-18-12/h3-10H,2H2,1H3,(H,17,19)(H,20,22)(H,21,23) |
| InChIKey | ZBOGUNHGRNEUAP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |