C13H18N6O3 — CID 166398495
8-[3-(1-methyltriazol-4-yl)propanoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 166398495) has the molecular formula C13H18N6O3 and a molecular weight of 306.33 g/mol. Its IUPAC name is 8-[3-(1-methyltriazol-4-yl)propanoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[3-(1-methyltriazol-4-yl)propanoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 166398495 |
| Molecular Formula | C13H18N6O3 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 8-[3-(1-methyltriazol-4-yl)propanoyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cn1cc(CCC(=O)N2CCC3(CC2)NC(=O)NC3=O)nn1 |
| InChI | InChI=1S/C13H18N6O3/c1-18-8-9(16-17-18)2-3-10(20)19-6-4-13(5-7-19)11(21)14-12(22)15-13/h8H,2-7H2,1H3,(H2,14,15,21,22) |
| InChIKey | MJKSWIMSGFDTND-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|