About 5-[2-(1,2,4-triazol-1-yl)ethyl]-1-[2-[2-(trifluoromethyl)phenyl]ethyl]tetrazole
5-[2-(1,2,4-triazol-1-yl)ethyl]-1-[2-[2-(trifluoromethyl)phenyl]ethyl]tetrazole (PubChem CID 166399867) has the molecular formula C14H14F3N7
and a molecular weight of 337.31 g/mol. Its IUPAC name is 5-[2-(1,2,4-triazol-1-yl)ethyl]-1-[2-[2-(trifluoromethyl)phenyl]ethyl]tetrazole.
Molecular Properties
| Compound Name | 5-[2-(1,2,4-triazol-1-yl)ethyl]-1-[2-[2-(trifluoromethyl)phenyl]ethyl]tetrazole |
| PubChem CID | 166399867 |
| Molecular Formula | C14H14F3N7 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 5-[2-(1,2,4-triazol-1-yl)ethyl]-1-[2-[2-(trifluoromethyl)phenyl]ethyl]tetrazole |
| SMILES | FC(F)(F)c1ccccc1CCn1nnnc1CCn1cncn1 |
| InChI | InChI=1S/C14H14F3N7/c15-14(16,17)12-4-2-1-3-11(12)5-8-24-13(20-21-22-24)6-7-23-10-18-9-19-23/h1-4,9-10H,5-8H2 |
| InChIKey | QGWJRVWKRYFSSG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[2-(1,2,4-triazol-1-yl)ethyl]-1-[2-[2-(trifluoromethyl)phenyl]ethyl]tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(1,2,4-triazol-1-yl)ethyl]-1-[2-[2-(trifluoromethyl)phenyl]ethyl]tetrazole?
The IUPAC name of 5-[2-(1,2,4-triazol-1-yl)ethyl]-1-[2-[2-(trifluoromethyl)phenyl]ethyl]tetrazole (CID 166399867) is 5-[2-(1,2,4-triazol-1-yl)ethyl]-1-[2-[2-(trifluoromethyl)phenyl]ethyl]tetrazole.
What is the SMILES notation for 5-[2-(1,2,4-triazol-1-yl)ethyl]-1-[2-[2-(trifluoromethyl)phenyl]ethyl]tetrazole?
The canonical SMILES for 5-[2-(1,2,4-triazol-1-yl)ethyl]-1-[2-[2-(trifluoromethyl)phenyl]ethyl]tetrazole is FC(F)(F)c1ccccc1CCn1nnnc1CCn1cncn1.
What is the InChIKey of 5-[2-(1,2,4-triazol-1-yl)ethyl]-1-[2-[2-(trifluoromethyl)phenyl]ethyl]tetrazole?
The InChIKey is QGWJRVWKRYFSSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3N7/c15-14(16,17)12-4-2-1-3-11(12)5-8-24-13(20-21-22-24)6-7-23-10-18-9-19-23/h1-4,9-10H,5-8H2.
What are the key properties of 5-[2-(1,2,4-triazol-1-yl)ethyl]-1-[2-[2-(trifluoromethyl)phenyl]ethyl]tetrazole?
5-[2-(1,2,4-triazol-1-yl)ethyl]-1-[2-[2-(trifluoromethyl)phenyl]ethyl]tetrazole has a molecular weight of 337.31 g/mol, XLogP of 1.77, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(1,2,4-triazol-1-yl)ethyl]-1-[2-[2-(trifluoromethyl)phenyl]ethyl]tetrazole is sourced from PubChem (CID 166399867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).