About 2-[[(4,4-difluorocyclohexyl)sulfonylamino]methyl]-3-methylimidazole-4-carboxylic acid
2-[[(4,4-difluorocyclohexyl)sulfonylamino]methyl]-3-methylimidazole-4-carboxylic acid (PubChem CID 166399972) has the molecular formula C12H17F2N3O4S
and a molecular weight of 337.35 g/mol. Its IUPAC name is 2-[[(4,4-difluorocyclohexyl)sulfonylamino]methyl]-3-methylimidazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[[(4,4-difluorocyclohexyl)sulfonylamino]methyl]-3-methylimidazole-4-carboxylic acid |
| PubChem CID | 166399972 |
| Molecular Formula | C12H17F2N3O4S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-[[(4,4-difluorocyclohexyl)sulfonylamino]methyl]-3-methylimidazole-4-carboxylic acid |
| SMILES | Cn1c(C(=O)O)cnc1CNS(=O)(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H17F2N3O4S/c1-17-9(11(18)19)6-15-10(17)7-16-22(20,21)8-2-4-12(13,14)5-3-8/h6,8,16H,2-5,7H2,1H3,(H,18,19) |
| InChIKey | LCHVMDKRPHGUAG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(4,4-difluorocyclohexyl)sulfonylamino]methyl]-3-methylimidazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(4,4-difluorocyclohexyl)sulfonylamino]methyl]-3-methylimidazole-4-carboxylic acid?
The IUPAC name of 2-[[(4,4-difluorocyclohexyl)sulfonylamino]methyl]-3-methylimidazole-4-carboxylic acid (CID 166399972) is 2-[[(4,4-difluorocyclohexyl)sulfonylamino]methyl]-3-methylimidazole-4-carboxylic acid.
What is the SMILES notation for 2-[[(4,4-difluorocyclohexyl)sulfonylamino]methyl]-3-methylimidazole-4-carboxylic acid?
The canonical SMILES for 2-[[(4,4-difluorocyclohexyl)sulfonylamino]methyl]-3-methylimidazole-4-carboxylic acid is Cn1c(C(=O)O)cnc1CNS(=O)(=O)C1CCC(F)(F)CC1.
What is the InChIKey of 2-[[(4,4-difluorocyclohexyl)sulfonylamino]methyl]-3-methylimidazole-4-carboxylic acid?
The InChIKey is LCHVMDKRPHGUAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2N3O4S/c1-17-9(11(18)19)6-15-10(17)7-16-22(20,21)8-2-4-12(13,14)5-3-8/h6,8,16H,2-5,7H2,1H3,(H,18,19).
What are the key properties of 2-[[(4,4-difluorocyclohexyl)sulfonylamino]methyl]-3-methylimidazole-4-carboxylic acid?
2-[[(4,4-difluorocyclohexyl)sulfonylamino]methyl]-3-methylimidazole-4-carboxylic acid has a molecular weight of 337.35 g/mol, XLogP of 1.12, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(4,4-difluorocyclohexyl)sulfonylamino]methyl]-3-methylimidazole-4-carboxylic acid is sourced from PubChem (CID 166399972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).