About docosa-4,15-dien-1-yn-3-ol
docosa-4,15-dien-1-yn-3-ol (PubChem CID 1664) has the molecular formula C22H38O
and a molecular weight of 318.55 g/mol. Its IUPAC name is docosa-4,15-dien-1-yn-3-ol.
Molecular Properties
| Compound Name | docosa-4,15-dien-1-yn-3-ol |
| PubChem CID | 1664 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | docosa-4,15-dien-1-yn-3-ol |
| SMILES | C#CC(O)C=CCCCCCCCCCC=CCCCCCC |
| InChI | InChI=1S/C22H38O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)4-2/h2,9-10,20-23H,3,5-8,11-19H2,1H3 |
| InChIKey | HEXQBSKJVUFXNG-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze docosa-4,15-dien-1-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of docosa-4,15-dien-1-yn-3-ol?
The IUPAC name of docosa-4,15-dien-1-yn-3-ol (CID 1664) is docosa-4,15-dien-1-yn-3-ol.
What is the SMILES notation for docosa-4,15-dien-1-yn-3-ol?
The canonical SMILES for docosa-4,15-dien-1-yn-3-ol is C#CC(O)C=CCCCCCCCCCC=CCCCCCC.
What is the InChIKey of docosa-4,15-dien-1-yn-3-ol?
The InChIKey is HEXQBSKJVUFXNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)4-2/h2,9-10,20-23H,3,5-8,11-19H2,1H3.
What are the key properties of docosa-4,15-dien-1-yn-3-ol?
docosa-4,15-dien-1-yn-3-ol has a molecular weight of 318.55 g/mol, XLogP of 6.57, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for docosa-4,15-dien-1-yn-3-ol is sourced from PubChem (CID 1664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).