C13H9F3N4O4S — CID 166400047
1-(2,5-dioxopyrrolidin-3-yl)-3-[4-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea (PubChem CID 166400047) has the molecular formula C13H9F3N4O4S and a molecular weight of 374.30 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-3-yl)-3-[4-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-(2,5-dioxopyrrolidin-3-yl)-3-[4-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 166400047 |
| Molecular Formula | C13H9F3N4O4S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-3-yl)-3-[4-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea |
| SMILES | O=C1CC(NC(=O)Nc2nc3c(OC(F)(F)F)cccc3s2)C(=O)N1 |
| InChI | InChI=1S/C13H9F3N4O4S/c14-13(15,16)24-6-2-1-3-7-9(6)19-12(25-7)20-11(23)17-5-4-8(21)18-10(5)22/h1-3,5H,4H2,(H,18,21,22)(H2,17,19,20,23) |
| InChIKey | IARDRUMPQGAECQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|