C16H14ClN3O3 — CID 166401794
4-N-[3-(4-chlorophenyl)oxetan-3-yl]pyridine-2,4-dicarboxamide (PubChem CID 166401794) has the molecular formula C16H14ClN3O3 and a molecular weight of 331.76 g/mol. Its IUPAC name is 4-N-[3-(4-chlorophenyl)oxetan-3-yl]pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-[3-(4-chlorophenyl)oxetan-3-yl]pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 166401794 |
| Molecular Formula | C16H14ClN3O3 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 4-N-[3-(4-chlorophenyl)oxetan-3-yl]pyridine-2,4-dicarboxamide |
| SMILES | NC(=O)c1cc(C(=O)NC2(c3ccc(Cl)cc3)COC2)ccn1 |
| InChI | InChI=1S/C16H14ClN3O3/c17-12-3-1-11(2-4-12)16(8-23-9-16)20-15(22)10-5-6-19-13(7-10)14(18)21/h1-7H,8-9H2,(H2,18,21)(H,20,22) |
| InChIKey | XRNCPAIRJQRDFC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |