About 4-(5,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carbonitrile
4-(5,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carbonitrile (PubChem CID 166402810) has the molecular formula C10H5F2N3
and a molecular weight of 205.17 g/mol. Its IUPAC name is 4-(5,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carbonitrile.
Molecular Properties
| Compound Name | 4-(5,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carbonitrile |
| PubChem CID | 166402810 |
| Molecular Formula | C10H5F2N3 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 4-(5,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carbonitrile |
| SMILES | N#Cc1cc(-c2cnc(F)c(F)c2)c[nH]1 |
| InChI | InChI=1S/C10H5F2N3/c11-9-2-7(5-15-10(9)12)6-1-8(3-13)14-4-6/h1-2,4-5,14H |
| InChIKey | FKZDKTSZDDNEGW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(5,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carbonitrile?
The IUPAC name of 4-(5,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carbonitrile (CID 166402810) is 4-(5,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carbonitrile.
What is the SMILES notation for 4-(5,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carbonitrile?
The canonical SMILES for 4-(5,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carbonitrile is N#Cc1cc(-c2cnc(F)c(F)c2)c[nH]1.
What is the InChIKey of 4-(5,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carbonitrile?
The InChIKey is FKZDKTSZDDNEGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F2N3/c11-9-2-7(5-15-10(9)12)6-1-8(3-13)14-4-6/h1-2,4-5,14H.
What are the key properties of 4-(5,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carbonitrile?
4-(5,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carbonitrile has a molecular weight of 205.17 g/mol, XLogP of 2.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-difluoro-3-pyridinyl)-1H-pyrrole-2-carbonitrile is sourced from PubChem (CID 166402810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).