C15H17N3O5S — CID 16640307
2-(aminomethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one;(Z)-but-2-enedioic acid (PubChem CID 16640307) has the molecular formula C15H17N3O5S and a molecular weight of 351.38 g/mol. Its IUPAC name is 2-(aminomethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one;(Z)-but-2-enedioic acid.
| Compound Name | 2-(aminomethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 16640307 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-(aminomethyl)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one;(Z)-but-2-enedioic acid |
| SMILES | NCc1nc2sc3c(c2c(=O)[nH]1)CCCC3.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C11H13N3OS.C4H4O4/c12-5-8-13-10(15)9-6-3-1-2-4-7(6)16-11(9)14-8;5-3(6)1-2-4(7)8/h1-5,12H2,(H,13,14,15);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | BRAKGALCXCQBMF-BTJKTKAUSA-N |
| XLogP | 1.03 |
| TPSA | 146.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|