C11H5FS4 — CID 16640443
5-(4-fluorophenyl)thieno[2,3-d][1,3]dithiole-2-thione (PubChem CID 16640443) has the molecular formula C11H5FS4 and a molecular weight of 284.43 g/mol. Its IUPAC name is 5-(4-fluorophenyl)thieno[2,3-d][1,3]dithiole-2-thione.
| Compound Name | 5-(4-fluorophenyl)thieno[2,3-d][1,3]dithiole-2-thione |
|---|---|
| PubChem CID | 16640443 |
| Molecular Formula | C11H5FS4 |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 283.93 |
| IUPAC Name | 5-(4-fluorophenyl)thieno[2,3-d][1,3]dithiole-2-thione |
| SMILES | Fc1ccc(-c2cc3sc(=S)sc3s2)cc1 |
| InChI | InChI=1S/C11H5FS4/c12-7-3-1-6(2-4-7)8-5-9-10(14-8)16-11(13)15-9/h1-5H |
| InChIKey | AWDHLSJQMMWWLV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|