C17H19N5O4 — CID 166404601
1-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-3-(1-oxo-2,3-dihydroisoindol-4-yl)urea (PubChem CID 166404601) has the molecular formula C17H19N5O4 and a molecular weight of 357.37 g/mol. Its IUPAC name is 1-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-3-(1-oxo-2,3-dihydroisoindol-4-yl)urea.
| Compound Name | 1-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-3-(1-oxo-2,3-dihydroisoindol-4-yl)urea |
|---|---|
| PubChem CID | 166404601 |
| Molecular Formula | C17H19N5O4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 1-[(2,4-dioxo-1,3-diazaspiro[4.4]nonan-9-yl)methyl]-3-(1-oxo-2,3-dihydroisoindol-4-yl)urea |
| SMILES | O=C(NCC1CCCC12NC(=O)NC2=O)Nc1cccc2c1CNC2=O |
| InChI | InChI=1S/C17H19N5O4/c23-13-10-4-1-5-12(11(10)8-18-13)20-15(25)19-7-9-3-2-6-17(9)14(24)21-16(26)22-17/h1,4-5,9H,2-3,6-8H2,(H,18,23)(H2,19,20,25)(H2,21,22,24,26) |
| InChIKey | GJWVBYCOHMZBHE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 128.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|