C19H15FN2O5S — CID 166404746
3-[[2-(3-pyridin-2-yloxyphenoxy)acetyl]amino]benzenesulfonyl fluoride (PubChem CID 166404746) has the molecular formula C19H15FN2O5S and a molecular weight of 402.40 g/mol. Its IUPAC name is 3-[[2-(3-pyridin-2-yloxyphenoxy)acetyl]amino]benzenesulfonyl fluoride.
| Compound Name | 3-[[2-(3-pyridin-2-yloxyphenoxy)acetyl]amino]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 166404746 |
| Molecular Formula | C19H15FN2O5S |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 3-[[2-(3-pyridin-2-yloxyphenoxy)acetyl]amino]benzenesulfonyl fluoride |
| SMILES | O=C(COc1cccc(Oc2ccccn2)c1)Nc1cccc(S(=O)(=O)F)c1 |
| InChI | InChI=1S/C19H15FN2O5S/c20-28(24,25)17-8-3-5-14(11-17)22-18(23)13-26-15-6-4-7-16(12-15)27-19-9-1-2-10-21-19/h1-12H,13H2,(H,22,23) |
| InChIKey | SGVDTVLYPHCJPZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |