C16H13FN4O3S — CID 166404942
N-[4-fluoro-3-(prop-2-enoylamino)phenyl]-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 166404942) has the molecular formula C16H13FN4O3S and a molecular weight of 360.37 g/mol. Its IUPAC name is N-[4-fluoro-3-(prop-2-enoylamino)phenyl]-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | N-[4-fluoro-3-(prop-2-enoylamino)phenyl]-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 166404942 |
| Molecular Formula | C16H13FN4O3S |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | N-[4-fluoro-3-(prop-2-enoylamino)phenyl]-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | C=CC(=O)Nc1cc(NC(=O)c2cnc3n(c2=O)CCS3)ccc1F |
| InChI | InChI=1S/C16H13FN4O3S/c1-2-13(22)20-12-7-9(3-4-11(12)17)19-14(23)10-8-18-16-21(15(10)24)5-6-25-16/h2-4,7-8H,1,5-6H2,(H,19,23)(H,20,22) |
| InChIKey | WQXHDFFWKMJDDT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|