C18H19F2N3O2S — CID 166405299
2-[2-(2,5-difluorophenyl)-1,3-thiazol-4-yl]-2-methyl-N-[2-(prop-2-enoylamino)ethyl]propanamide (PubChem CID 166405299) has the molecular formula C18H19F2N3O2S and a molecular weight of 379.43 g/mol. Its IUPAC name is 2-[2-(2,5-difluorophenyl)-1,3-thiazol-4-yl]-2-methyl-N-[2-(prop-2-enoylamino)ethyl]propanamide.
| Compound Name | 2-[2-(2,5-difluorophenyl)-1,3-thiazol-4-yl]-2-methyl-N-[2-(prop-2-enoylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 166405299 |
| Molecular Formula | C18H19F2N3O2S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-[2-(2,5-difluorophenyl)-1,3-thiazol-4-yl]-2-methyl-N-[2-(prop-2-enoylamino)ethyl]propanamide |
| SMILES | C=CC(=O)NCCNC(=O)C(C)(C)c1csc(-c2cc(F)ccc2F)n1 |
| InChI | InChI=1S/C18H19F2N3O2S/c1-4-15(24)21-7-8-22-17(25)18(2,3)14-10-26-16(23-14)12-9-11(19)5-6-13(12)20/h4-6,9-10H,1,7-8H2,2-3H3,(H,21,24)(H,22,25) |
| InChIKey | PYAYBULWZKOESD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|