C16H20F3N5O2S — CID 166405310
1-[4-[4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]piperazine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 166405310) has the molecular formula C16H20F3N5O2S and a molecular weight of 403.43 g/mol. Its IUPAC name is 1-[4-[4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]piperazine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]piperazine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166405310 |
| Molecular Formula | C16H20F3N5O2S |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-[4-[4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]piperazine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(C(=O)N2CCN(c3nnc(C(F)(F)F)s3)CC2)CC1 |
| InChI | InChI=1S/C16H20F3N5O2S/c1-2-12(25)22-5-3-11(4-6-22)13(26)23-7-9-24(10-8-23)15-21-20-14(27-15)16(17,18)19/h2,11H,1,3-10H2 |
| InChIKey | HQVFYBFMYDZTSS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|