C20H17Cl2N3O3 — CID 166405501
2,5-dichloro-N-[[3-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]pyridine-4-carboxamide (PubChem CID 166405501) has the molecular formula C20H17Cl2N3O3 and a molecular weight of 418.28 g/mol. Its IUPAC name is 2,5-dichloro-N-[[3-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-[[3-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 166405501 |
| Molecular Formula | C20H17Cl2N3O3 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 2,5-dichloro-N-[[3-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]pyridine-4-carboxamide |
| SMILES | COc1cc(CNC(=O)c2cc(Cl)ncc2Cl)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C20H17Cl2N3O3/c1-27-18-7-13(4-5-17(18)28-12-14-3-2-6-23-9-14)10-25-20(26)15-8-19(22)24-11-16(15)21/h2-9,11H,10,12H2,1H3,(H,25,26) |
| InChIKey | LQYDJOYCUFOYLY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|