C17H14FN3O3S — CID 166405531
(2-fluoro-5-methylphenyl)-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl]cyanamide (PubChem CID 166405531) has the molecular formula C17H14FN3O3S and a molecular weight of 359.38 g/mol. Its IUPAC name is (2-fluoro-5-methylphenyl)-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl]cyanamide.
| Compound Name | (2-fluoro-5-methylphenyl)-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl]cyanamide |
|---|---|
| PubChem CID | 166405531 |
| Molecular Formula | C17H14FN3O3S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | (2-fluoro-5-methylphenyl)-[2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethyl]cyanamide |
| SMILES | Cc1ccc(F)c(N(C#N)CCN2C(=O)c3ccccc3S2(=O)=O)c1 |
| InChI | InChI=1S/C17H14FN3O3S/c1-12-6-7-14(18)15(10-12)20(11-19)8-9-21-17(22)13-4-2-3-5-16(13)25(21,23)24/h2-7,10H,8-9H2,1H3 |
| InChIKey | IYYFFEQACARNRE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|