C19H21N3O2S — CID 166405559
N-[4-(4-methyl-1,3-thiazol-2-yl)phenyl]-1-prop-2-enoylpiperidine-4-carboxamide (PubChem CID 166405559) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-[4-(4-methyl-1,3-thiazol-2-yl)phenyl]-1-prop-2-enoylpiperidine-4-carboxamide.
| Compound Name | N-[4-(4-methyl-1,3-thiazol-2-yl)phenyl]-1-prop-2-enoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 166405559 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[4-(4-methyl-1,3-thiazol-2-yl)phenyl]-1-prop-2-enoylpiperidine-4-carboxamide |
| SMILES | C=CC(=O)N1CCC(C(=O)Nc2ccc(-c3nc(C)cs3)cc2)CC1 |
| InChI | InChI=1S/C19H21N3O2S/c1-3-17(23)22-10-8-14(9-11-22)18(24)21-16-6-4-15(5-7-16)19-20-13(2)12-25-19/h3-7,12,14H,1,8-11H2,2H3,(H,21,24) |
| InChIKey | HOKWASJOTZBHQA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|