C17H17Cl2N3O2 — CID 166405715
N-[3-(6,8-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-oxopropyl]prop-2-enamide (PubChem CID 166405715) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is N-[3-(6,8-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-oxopropyl]prop-2-enamide.
| Compound Name | N-[3-(6,8-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-oxopropyl]prop-2-enamide |
|---|---|
| PubChem CID | 166405715 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-[3-(6,8-dichloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-oxopropyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCC(=O)N1CCc2[nH]c3c(Cl)cc(Cl)cc3c2C1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-2-15(23)20-5-3-16(24)22-6-4-14-12(9-22)11-7-10(18)8-13(19)17(11)21-14/h2,7-8,21H,1,3-6,9H2,(H,20,23) |
| InChIKey | NIFXDLNIVROBEV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|