C21H28N2O4 — CID 166406542
N-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]piperidin-1-yl]-2-oxoethyl]-N-methylprop-2-enamide (PubChem CID 166406542) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]piperidin-1-yl]-2-oxoethyl]-N-methylprop-2-enamide.
| Compound Name | N-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]piperidin-1-yl]-2-oxoethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 166406542 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[2-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]piperidin-1-yl]-2-oxoethyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)CC(=O)N1CCC(Oc2cccc3c2OC(C)(C)C3)CC1 |
| InChI | InChI=1S/C21H28N2O4/c1-5-18(24)22(4)14-19(25)23-11-9-16(10-12-23)26-17-8-6-7-15-13-21(2,3)27-20(15)17/h5-8,16H,1,9-14H2,2-4H3 |
| InChIKey | JOIKRLBFRXYQNE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|