About N-ethyl-N-[2-oxo-2-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]ethyl]prop-2-enamide
N-ethyl-N-[2-oxo-2-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]ethyl]prop-2-enamide (PubChem CID 166407605) has the molecular formula C14H22F3N3O2
and a molecular weight of 321.34 g/mol. Its IUPAC name is N-ethyl-N-[2-oxo-2-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]ethyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-ethyl-N-[2-oxo-2-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]ethyl]prop-2-enamide |
| PubChem CID | 166407605 |
| Molecular Formula | C14H22F3N3O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-ethyl-N-[2-oxo-2-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CC)CC(=O)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H22F3N3O2/c1-4-12(21)18(5-2)10-13(22)20-8-6-19(7-9-20)11(3)14(15,16)17/h4,11H,1,5-10H2,2-3H3 |
| InChIKey | PWKITIFEXRBRSF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-[2-oxo-2-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]ethyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[2-oxo-2-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]ethyl]prop-2-enamide?
The IUPAC name of N-ethyl-N-[2-oxo-2-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]ethyl]prop-2-enamide (CID 166407605) is N-ethyl-N-[2-oxo-2-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]ethyl]prop-2-enamide.
What is the SMILES notation for N-ethyl-N-[2-oxo-2-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]ethyl]prop-2-enamide?
The canonical SMILES for N-ethyl-N-[2-oxo-2-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]ethyl]prop-2-enamide is C=CC(=O)N(CC)CC(=O)N1CCN(C(C)C(F)(F)F)CC1.
What is the InChIKey of N-ethyl-N-[2-oxo-2-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]ethyl]prop-2-enamide?
The InChIKey is PWKITIFEXRBRSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F3N3O2/c1-4-12(21)18(5-2)10-13(22)20-8-6-19(7-9-20)11(3)14(15,16)17/h4,11H,1,5-10H2,2-3H3.
What are the key properties of N-ethyl-N-[2-oxo-2-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]ethyl]prop-2-enamide?
N-ethyl-N-[2-oxo-2-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]ethyl]prop-2-enamide has a molecular weight of 321.34 g/mol, XLogP of 1.12, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[2-oxo-2-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]ethyl]prop-2-enamide is sourced from PubChem (CID 166407605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).