C14H20F3N3O3 — CID 166407683
1-[2-[ethyl(prop-2-enoyl)amino]acetyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide (PubChem CID 166407683) has the molecular formula C14H20F3N3O3 and a molecular weight of 335.33 g/mol. Its IUPAC name is 1-[2-[ethyl(prop-2-enoyl)amino]acetyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-[2-[ethyl(prop-2-enoyl)amino]acetyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 166407683 |
| Molecular Formula | C14H20F3N3O3 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[2-[ethyl(prop-2-enoyl)amino]acetyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
| SMILES | C=CC(=O)N(CC)CC(=O)N1CCC(C(=O)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C14H20F3N3O3/c1-3-11(21)19(4-2)8-12(22)20-6-5-10(7-20)13(23)18-9-14(15,16)17/h3,10H,1,4-9H2,2H3,(H,18,23) |
| InChIKey | BPNHSRDZXPPMGS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|