C12H15F3N4O3 — CID 166407737
N-ethyl-N-[2-oxo-2-[1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]ethylamino]ethyl]prop-2-enamide (PubChem CID 166407737) has the molecular formula C12H15F3N4O3 and a molecular weight of 320.27 g/mol. Its IUPAC name is N-ethyl-N-[2-oxo-2-[1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]ethylamino]ethyl]prop-2-enamide.
| Compound Name | N-ethyl-N-[2-oxo-2-[1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]ethylamino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 166407737 |
| Molecular Formula | C12H15F3N4O3 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | N-ethyl-N-[2-oxo-2-[1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]ethylamino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CC)CC(=O)NC(C)c1nc(C(F)(F)F)no1 |
| InChI | InChI=1S/C12H15F3N4O3/c1-4-9(21)19(5-2)6-8(20)16-7(3)10-17-11(18-22-10)12(13,14)15/h4,7H,1,5-6H2,2-3H3,(H,16,20) |
| InChIKey | FLFBFPUCDFKFJE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|