C16H25N5O3 — CID 166407739
N-ethyl-N-[2-[4-(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-2-oxoethyl]prop-2-enamide (PubChem CID 166407739) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-ethyl-N-[2-[4-(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-2-oxoethyl]prop-2-enamide.
| Compound Name | N-ethyl-N-[2-[4-(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 166407739 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N-ethyl-N-[2-[4-(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)piperidin-1-yl]-2-oxoethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CC)CC(=O)N1CCC(c2n[nH]c(=O)n2CC)CC1 |
| InChI | InChI=1S/C16H25N5O3/c1-4-13(22)19(5-2)11-14(23)20-9-7-12(8-10-20)15-17-18-16(24)21(15)6-3/h4,12H,1,5-11H2,2-3H3,(H,18,24) |
| InChIKey | SPNGFVCBGUBEBX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|