C14H22F3N3O2 — CID 166407958
N-[3-[(3S,5R)-3,5-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-3-oxopropyl]prop-2-enamide (PubChem CID 166407958) has the molecular formula C14H22F3N3O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is N-[3-[(3S,5R)-3,5-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-3-oxopropyl]prop-2-enamide.
| Compound Name | N-[3-[(3S,5R)-3,5-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-3-oxopropyl]prop-2-enamide |
|---|---|
| PubChem CID | 166407958 |
| Molecular Formula | C14H22F3N3O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-[3-[(3S,5R)-3,5-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-3-oxopropyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCC(=O)N1C[C@@H](C)N(CC(F)(F)F)[C@@H](C)C1 |
| InChI | InChI=1S/C14H22F3N3O2/c1-4-12(21)18-6-5-13(22)19-7-10(2)20(11(3)8-19)9-14(15,16)17/h4,10-11H,1,5-9H2,2-3H3,(H,18,21)/t10-,11+ |
| InChIKey | BSGOWPFQMJCCBS-PHIMTYICSA-N |
| XLogP | 1.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|