C15H14ClNO2 — CID 166408897
2-chloro-1-(2-phenyl-6,7-dihydro-4H-furo[3,2-c]pyridin-5-yl)ethanone (PubChem CID 166408897) has the molecular formula C15H14ClNO2 and a molecular weight of 275.74 g/mol. Its IUPAC name is 2-chloro-1-(2-phenyl-6,7-dihydro-4H-furo[3,2-c]pyridin-5-yl)ethanone.
| Compound Name | 2-chloro-1-(2-phenyl-6,7-dihydro-4H-furo[3,2-c]pyridin-5-yl)ethanone |
|---|---|
| PubChem CID | 166408897 |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-chloro-1-(2-phenyl-6,7-dihydro-4H-furo[3,2-c]pyridin-5-yl)ethanone |
| SMILES | O=C(CCl)N1CCc2oc(-c3ccccc3)cc2C1 |
| InChI | InChI=1S/C15H14ClNO2/c16-9-15(18)17-7-6-13-12(10-17)8-14(19-13)11-4-2-1-3-5-11/h1-5,8H,6-7,9-10H2 |
| InChIKey | IORLDUDWHVSNIW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|