C17H22N2O2 — CID 166408983
N-[(2R,3S)-1-cyclopropyl-2-(3-methoxyphenyl)pyrrolidin-3-yl]prop-2-enamide (PubChem CID 166408983) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-[(2R,3S)-1-cyclopropyl-2-(3-methoxyphenyl)pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[(2R,3S)-1-cyclopropyl-2-(3-methoxyphenyl)pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 166408983 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-[(2R,3S)-1-cyclopropyl-2-(3-methoxyphenyl)pyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCN(C2CC2)[C@@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C17H22N2O2/c1-3-16(20)18-15-9-10-19(13-7-8-13)17(15)12-5-4-6-14(11-12)21-2/h3-6,11,13,15,17H,1,7-10H2,2H3,(H,18,20)/t15-,17+/m0/s1 |
| InChIKey | LKPGPECIPUPLET-DOTOQJQBSA-N |
| XLogP | 2.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|