C21H28N2O3 — CID 166410321
(4Z,11S)-11-methylspiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,1'-cyclohexane]-8,13-dione (PubChem CID 166410321) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is (4Z,11S)-11-methylspiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,1'-cyclohexane]-8,13-dione.
| Compound Name | (4Z,11S)-11-methylspiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,1'-cyclohexane]-8,13-dione |
|---|---|
| PubChem CID | 166410321 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (4Z,11S)-11-methylspiro[2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),4,14,16-tetraene-7,1'-cyclohexane]-8,13-dione |
| SMILES | C[C@H]1CNC(=O)C2(C/C=C\COc3ccccc3C(=O)N1)CCCCC2 |
| InChI | InChI=1S/C21H28N2O3/c1-16-15-22-20(25)21(11-5-2-6-12-21)13-7-8-14-26-18-10-4-3-9-17(18)19(24)23-16/h3-4,7-10,16H,2,5-6,11-15H2,1H3,(H,22,25)(H,23,24)/b8-7-/t16-/m0/s1 |
| InChIKey | CLCOKWSWHVKDIR-PTZVLDCSSA-N |
| XLogP | 3.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|