C14H17N5O — CID 166410481
1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(4,5-dimethyl-2-pyridinyl)urea (PubChem CID 166410481) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(4,5-dimethyl-2-pyridinyl)urea.
| Compound Name | 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(4,5-dimethyl-2-pyridinyl)urea |
|---|---|
| PubChem CID | 166410481 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-(5-cyclopropyl-1H-pyrazol-4-yl)-3-(4,5-dimethyl-2-pyridinyl)urea |
| SMILES | Cc1cnc(NC(=O)Nc2cn[nH]c2C2CC2)cc1C |
| InChI | InChI=1S/C14H17N5O/c1-8-5-12(15-6-9(8)2)18-14(20)17-11-7-16-19-13(11)10-3-4-10/h5-7,10H,3-4H2,1-2H3,(H,16,19)(H2,15,17,18,20) |
| InChIKey | JIJCPFKUCGPWMA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |