About N-[3-[(2R,4R)-4-methyl-2-(5-methylfuran-2-yl)piperidin-1-yl]-3-oxopropyl]prop-2-enamide
N-[3-[(2R,4R)-4-methyl-2-(5-methylfuran-2-yl)piperidin-1-yl]-3-oxopropyl]prop-2-enamide (PubChem CID 166411128) has the molecular formula C17H24N2O3
and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[3-[(2R,4R)-4-methyl-2-(5-methylfuran-2-yl)piperidin-1-yl]-3-oxopropyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[3-[(2R,4R)-4-methyl-2-(5-methylfuran-2-yl)piperidin-1-yl]-3-oxopropyl]prop-2-enamide |
| PubChem CID | 166411128 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[3-[(2R,4R)-4-methyl-2-(5-methylfuran-2-yl)piperidin-1-yl]-3-oxopropyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCC(=O)N1CC[C@@H](C)C[C@@H]1c1ccc(C)o1 |
| InChI | InChI=1S/C17H24N2O3/c1-4-16(20)18-9-7-17(21)19-10-8-12(2)11-14(19)15-6-5-13(3)22-15/h4-6,12,14H,1,7-11H2,2-3H3,(H,18,20)/t12-,14-/m1/s1 |
| InChIKey | JZZJFSMKLXUWEK-TZMCWYRMSA-N |
| XLogP | 2.58 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(2R,4R)-4-methyl-2-(5-methylfuran-2-yl)piperidin-1-yl]-3-oxopropyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(2R,4R)-4-methyl-2-(5-methylfuran-2-yl)piperidin-1-yl]-3-oxopropyl]prop-2-enamide?
The IUPAC name of N-[3-[(2R,4R)-4-methyl-2-(5-methylfuran-2-yl)piperidin-1-yl]-3-oxopropyl]prop-2-enamide (CID 166411128) is N-[3-[(2R,4R)-4-methyl-2-(5-methylfuran-2-yl)piperidin-1-yl]-3-oxopropyl]prop-2-enamide.
What is the SMILES notation for N-[3-[(2R,4R)-4-methyl-2-(5-methylfuran-2-yl)piperidin-1-yl]-3-oxopropyl]prop-2-enamide?
The canonical SMILES for N-[3-[(2R,4R)-4-methyl-2-(5-methylfuran-2-yl)piperidin-1-yl]-3-oxopropyl]prop-2-enamide is C=CC(=O)NCCC(=O)N1CC[C@@H](C)C[C@@H]1c1ccc(C)o1.
What is the InChIKey of N-[3-[(2R,4R)-4-methyl-2-(5-methylfuran-2-yl)piperidin-1-yl]-3-oxopropyl]prop-2-enamide?
The InChIKey is JZZJFSMKLXUWEK-TZMCWYRMSA-N. The full InChI is InChI=1S/C17H24N2O3/c1-4-16(20)18-9-7-17(21)19-10-8-12(2)11-14(19)15-6-5-13(3)22-15/h4-6,12,14H,1,7-11H2,2-3H3,(H,18,20)/t12-,14-/m1/s1.
What are the key properties of N-[3-[(2R,4R)-4-methyl-2-(5-methylfuran-2-yl)piperidin-1-yl]-3-oxopropyl]prop-2-enamide?
N-[3-[(2R,4R)-4-methyl-2-(5-methylfuran-2-yl)piperidin-1-yl]-3-oxopropyl]prop-2-enamide has a molecular weight of 304.39 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(2R,4R)-4-methyl-2-(5-methylfuran-2-yl)piperidin-1-yl]-3-oxopropyl]prop-2-enamide is sourced from PubChem (CID 166411128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).