C15H18N2O3 — CID 166411557
N-[2-[[(1S)-1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]amino]-2-oxoethyl]prop-2-enamide (PubChem CID 166411557) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-[2-[[(1S)-1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]amino]-2-oxoethyl]prop-2-enamide.
| Compound Name | N-[2-[[(1S)-1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]amino]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 166411557 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[2-[[(1S)-1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]amino]-2-oxoethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(=O)N[C@@H](C)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C15H18N2O3/c1-3-14(18)16-9-15(19)17-10(2)11-4-5-13-12(8-11)6-7-20-13/h3-5,8,10H,1,6-7,9H2,2H3,(H,16,18)(H,17,19)/t10-/m0/s1 |
| InChIKey | DROYYBXFIWLMEL-JTQLQIEISA-N |
| XLogP | 1.10 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|