C20H21N3O3S — CID 166411576
N-[2-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)-2-methylanilino]-2-oxoethyl]prop-2-enamide (PubChem CID 166411576) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[2-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)-2-methylanilino]-2-oxoethyl]prop-2-enamide.
| Compound Name | N-[2-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)-2-methylanilino]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 166411576 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[2-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbonyl)-2-methylanilino]-2-oxoethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(=O)Nc1cccc(C(=O)N2CCc3sccc3C2)c1C |
| InChI | InChI=1S/C20H21N3O3S/c1-3-18(24)21-11-19(25)22-16-6-4-5-15(13(16)2)20(26)23-9-7-17-14(12-23)8-10-27-17/h3-6,8,10H,1,7,9,11-12H2,2H3,(H,21,24)(H,22,25) |
| InChIKey | VAGULGSIQLVMHX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|