C21H24N4O4S — CID 166412120
tert-butyl 2-[[3-(prop-2-enoylamino)benzoyl]amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate (PubChem CID 166412120) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is tert-butyl 2-[[3-(prop-2-enoylamino)benzoyl]amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 2-[[3-(prop-2-enoylamino)benzoyl]amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 166412120 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | tert-butyl 2-[[3-(prop-2-enoylamino)benzoyl]amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate |
| SMILES | C=CC(=O)Nc1cccc(C(=O)Nc2nc3c(s2)CN(C(=O)OC(C)(C)C)CC3)c1 |
| InChI | InChI=1S/C21H24N4O4S/c1-5-17(26)22-14-8-6-7-13(11-14)18(27)24-19-23-15-9-10-25(12-16(15)30-19)20(28)29-21(2,3)4/h5-8,11H,1,9-10,12H2,2-4H3,(H,22,26)(H,23,24,27) |
| InChIKey | LELHPQKIFLQDFZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|