C20H24BrN3O3 — CID 166413014
N-[1-(4-bromophenyl)-2-oxopiperidin-3-yl]-1-prop-2-enoylpiperidine-3-carboxamide (PubChem CID 166413014) has the molecular formula C20H24BrN3O3 and a molecular weight of 434.33 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2-oxopiperidin-3-yl]-1-prop-2-enoylpiperidine-3-carboxamide.
| Compound Name | N-[1-(4-bromophenyl)-2-oxopiperidin-3-yl]-1-prop-2-enoylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 166413014 |
| Molecular Formula | C20H24BrN3O3 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-[1-(4-bromophenyl)-2-oxopiperidin-3-yl]-1-prop-2-enoylpiperidine-3-carboxamide |
| SMILES | C=CC(=O)N1CCCC(C(=O)NC2CCCN(c3ccc(Br)cc3)C2=O)C1 |
| InChI | InChI=1S/C20H24BrN3O3/c1-2-18(25)23-11-3-5-14(13-23)19(26)22-17-6-4-12-24(20(17)27)16-9-7-15(21)8-10-16/h2,7-10,14,17H,1,3-6,11-13H2,(H,22,26) |
| InChIKey | NRGCXDKNVVOLST-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|