C22H31N3O4 — CID 166413377
tert-butyl 2-[2-[3-(prop-2-enoylamino)propanoylamino]ethyl]-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 166413377) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is tert-butyl 2-[2-[3-(prop-2-enoylamino)propanoylamino]ethyl]-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[3-(prop-2-enoylamino)propanoylamino]ethyl]-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 166413377 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | tert-butyl 2-[2-[3-(prop-2-enoylamino)propanoylamino]ethyl]-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | C=CC(=O)NCCC(=O)NCCC1CCc2ccccc2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H31N3O4/c1-5-19(26)23-15-13-20(27)24-14-12-17-11-10-16-8-6-7-9-18(16)25(17)21(28)29-22(2,3)4/h5-9,17H,1,10-15H2,2-4H3,(H,23,26)(H,24,27) |
| InChIKey | QOKACDVJCNBAJY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|