C13H14ClN3O3 — CID 166413380
5-chloro-2-[3-(prop-2-enoylamino)propanoylamino]benzamide (PubChem CID 166413380) has the molecular formula C13H14ClN3O3 and a molecular weight of 295.73 g/mol. Its IUPAC name is 5-chloro-2-[3-(prop-2-enoylamino)propanoylamino]benzamide.
| Compound Name | 5-chloro-2-[3-(prop-2-enoylamino)propanoylamino]benzamide |
|---|---|
| PubChem CID | 166413380 |
| Molecular Formula | C13H14ClN3O3 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 5-chloro-2-[3-(prop-2-enoylamino)propanoylamino]benzamide |
| SMILES | C=CC(=O)NCCC(=O)Nc1ccc(Cl)cc1C(N)=O |
| InChI | InChI=1S/C13H14ClN3O3/c1-2-11(18)16-6-5-12(19)17-10-4-3-8(14)7-9(10)13(15)20/h2-4,7H,1,5-6H2,(H2,15,20)(H,16,18)(H,17,19) |
| InChIKey | YWLOPYHDZLNGHX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|