About N-[4-(4-ethyl-2,2-dimethyl-3-oxopiperazine-1-carbonyl)phenyl]-N-methylprop-2-enamide
N-[4-(4-ethyl-2,2-dimethyl-3-oxopiperazine-1-carbonyl)phenyl]-N-methylprop-2-enamide (PubChem CID 166413553) has the molecular formula C19H25N3O3
and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[4-(4-ethyl-2,2-dimethyl-3-oxopiperazine-1-carbonyl)phenyl]-N-methylprop-2-enamide.
Molecular Properties
| Compound Name | N-[4-(4-ethyl-2,2-dimethyl-3-oxopiperazine-1-carbonyl)phenyl]-N-methylprop-2-enamide |
| PubChem CID | 166413553 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[4-(4-ethyl-2,2-dimethyl-3-oxopiperazine-1-carbonyl)phenyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)c1ccc(C(=O)N2CCN(CC)C(=O)C2(C)C)cc1 |
| InChI | InChI=1S/C19H25N3O3/c1-6-16(23)20(5)15-10-8-14(9-11-15)17(24)22-13-12-21(7-2)18(25)19(22,3)4/h6,8-11H,1,7,12-13H2,2-5H3 |
| InChIKey | AZRCKPZUSRFUCM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(4-ethyl-2,2-dimethyl-3-oxopiperazine-1-carbonyl)phenyl]-N-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4-ethyl-2,2-dimethyl-3-oxopiperazine-1-carbonyl)phenyl]-N-methylprop-2-enamide?
The IUPAC name of N-[4-(4-ethyl-2,2-dimethyl-3-oxopiperazine-1-carbonyl)phenyl]-N-methylprop-2-enamide (CID 166413553) is N-[4-(4-ethyl-2,2-dimethyl-3-oxopiperazine-1-carbonyl)phenyl]-N-methylprop-2-enamide.
What is the SMILES notation for N-[4-(4-ethyl-2,2-dimethyl-3-oxopiperazine-1-carbonyl)phenyl]-N-methylprop-2-enamide?
The canonical SMILES for N-[4-(4-ethyl-2,2-dimethyl-3-oxopiperazine-1-carbonyl)phenyl]-N-methylprop-2-enamide is C=CC(=O)N(C)c1ccc(C(=O)N2CCN(CC)C(=O)C2(C)C)cc1.
What is the InChIKey of N-[4-(4-ethyl-2,2-dimethyl-3-oxopiperazine-1-carbonyl)phenyl]-N-methylprop-2-enamide?
The InChIKey is AZRCKPZUSRFUCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3O3/c1-6-16(23)20(5)15-10-8-14(9-11-15)17(24)22-13-12-21(7-2)18(25)19(22,3)4/h6,8-11H,1,7,12-13H2,2-5H3.
What are the key properties of N-[4-(4-ethyl-2,2-dimethyl-3-oxopiperazine-1-carbonyl)phenyl]-N-methylprop-2-enamide?
N-[4-(4-ethyl-2,2-dimethyl-3-oxopiperazine-1-carbonyl)phenyl]-N-methylprop-2-enamide has a molecular weight of 343.43 g/mol, XLogP of 1.92, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4-ethyl-2,2-dimethyl-3-oxopiperazine-1-carbonyl)phenyl]-N-methylprop-2-enamide is sourced from PubChem (CID 166413553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).