C20H26N4O2 — CID 166414015
N-(1-ethylpyrazol-4-yl)-4-[methyl(prop-2-enoyl)amino]-N-(2-methylpropyl)benzamide (PubChem CID 166414015) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-(1-ethylpyrazol-4-yl)-4-[methyl(prop-2-enoyl)amino]-N-(2-methylpropyl)benzamide.
| Compound Name | N-(1-ethylpyrazol-4-yl)-4-[methyl(prop-2-enoyl)amino]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 166414015 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | N-(1-ethylpyrazol-4-yl)-4-[methyl(prop-2-enoyl)amino]-N-(2-methylpropyl)benzamide |
| SMILES | C=CC(=O)N(C)c1ccc(C(=O)N(CC(C)C)c2cnn(CC)c2)cc1 |
| InChI | InChI=1S/C20H26N4O2/c1-6-19(25)22(5)17-10-8-16(9-11-17)20(26)24(13-15(3)4)18-12-21-23(7-2)14-18/h6,8-12,14-15H,1,7,13H2,2-5H3 |
| InChIKey | JAOHIABOAIOKEU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|