C18H16ClN3O3 — CID 166414265
3-chloro-5-[[4-[methyl(prop-2-enoyl)amino]benzoyl]amino]benzamide (PubChem CID 166414265) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is 3-chloro-5-[[4-[methyl(prop-2-enoyl)amino]benzoyl]amino]benzamide.
| Compound Name | 3-chloro-5-[[4-[methyl(prop-2-enoyl)amino]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 166414265 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 3-chloro-5-[[4-[methyl(prop-2-enoyl)amino]benzoyl]amino]benzamide |
| SMILES | C=CC(=O)N(C)c1ccc(C(=O)Nc2cc(Cl)cc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C18H16ClN3O3/c1-3-16(23)22(2)15-6-4-11(5-7-15)18(25)21-14-9-12(17(20)24)8-13(19)10-14/h3-10H,1H2,2H3,(H2,20,24)(H,21,25) |
| InChIKey | DQFQXXSTWXLPND-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|