About 6-amino-3-(4-methoxy-1,3-benzothiazol-2-yl)quinazolin-4-one
6-amino-3-(4-methoxy-1,3-benzothiazol-2-yl)quinazolin-4-one (PubChem CID 16641569) has the molecular formula C16H12N4O2S
and a molecular weight of 324.37 g/mol. Its IUPAC name is 6-amino-3-(4-methoxy-1,3-benzothiazol-2-yl)quinazolin-4-one.
Molecular Properties
| Compound Name | 6-amino-3-(4-methoxy-1,3-benzothiazol-2-yl)quinazolin-4-one |
| PubChem CID | 16641569 |
| Molecular Formula | C16H12N4O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 6-amino-3-(4-methoxy-1,3-benzothiazol-2-yl)quinazolin-4-one |
| SMILES | COc1cccc2sc(-n3cnc4ccc(N)cc4c3=O)nc12 |
| InChI | InChI=1S/C16H12N4O2S/c1-22-12-3-2-4-13-14(12)19-16(23-13)20-8-18-11-6-5-9(17)7-10(11)15(20)21/h2-8H,17H2,1H3 |
| InChIKey | QXCCJDWAPNIZCQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-3-(4-methoxy-1,3-benzothiazol-2-yl)quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-(4-methoxy-1,3-benzothiazol-2-yl)quinazolin-4-one?
The IUPAC name of 6-amino-3-(4-methoxy-1,3-benzothiazol-2-yl)quinazolin-4-one (CID 16641569) is 6-amino-3-(4-methoxy-1,3-benzothiazol-2-yl)quinazolin-4-one.
What is the SMILES notation for 6-amino-3-(4-methoxy-1,3-benzothiazol-2-yl)quinazolin-4-one?
The canonical SMILES for 6-amino-3-(4-methoxy-1,3-benzothiazol-2-yl)quinazolin-4-one is COc1cccc2sc(-n3cnc4ccc(N)cc4c3=O)nc12.
What is the InChIKey of 6-amino-3-(4-methoxy-1,3-benzothiazol-2-yl)quinazolin-4-one?
The InChIKey is QXCCJDWAPNIZCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O2S/c1-22-12-3-2-4-13-14(12)19-16(23-13)20-8-18-11-6-5-9(17)7-10(11)15(20)21/h2-8H,17H2,1H3.
What are the key properties of 6-amino-3-(4-methoxy-1,3-benzothiazol-2-yl)quinazolin-4-one?
6-amino-3-(4-methoxy-1,3-benzothiazol-2-yl)quinazolin-4-one has a molecular weight of 324.37 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-(4-methoxy-1,3-benzothiazol-2-yl)quinazolin-4-one is sourced from PubChem (CID 16641569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).