About N-[2-(5,6-dihydro-4H-cyclopenta[c]thiophen-5-ylamino)-2-oxoethyl]-N-methylprop-2-enamide
N-[2-(5,6-dihydro-4H-cyclopenta[c]thiophen-5-ylamino)-2-oxoethyl]-N-methylprop-2-enamide (PubChem CID 166416058) has the molecular formula C13H16N2O2S
and a molecular weight of 264.35 g/mol. Its IUPAC name is N-[2-(5,6-dihydro-4H-cyclopenta[c]thiophen-5-ylamino)-2-oxoethyl]-N-methylprop-2-enamide.
Molecular Properties
| Compound Name | N-[2-(5,6-dihydro-4H-cyclopenta[c]thiophen-5-ylamino)-2-oxoethyl]-N-methylprop-2-enamide |
| PubChem CID | 166416058 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-[2-(5,6-dihydro-4H-cyclopenta[c]thiophen-5-ylamino)-2-oxoethyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)CC(=O)NC1Cc2cscc2C1 |
| InChI | InChI=1S/C13H16N2O2S/c1-3-13(17)15(2)6-12(16)14-11-4-9-7-18-8-10(9)5-11/h3,7-8,11H,1,4-6H2,2H3,(H,14,16) |
| InChIKey | NHBKNDAVESKMMI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(5,6-dihydro-4H-cyclopenta[c]thiophen-5-ylamino)-2-oxoethyl]-N-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5,6-dihydro-4H-cyclopenta[c]thiophen-5-ylamino)-2-oxoethyl]-N-methylprop-2-enamide?
The IUPAC name of N-[2-(5,6-dihydro-4H-cyclopenta[c]thiophen-5-ylamino)-2-oxoethyl]-N-methylprop-2-enamide (CID 166416058) is N-[2-(5,6-dihydro-4H-cyclopenta[c]thiophen-5-ylamino)-2-oxoethyl]-N-methylprop-2-enamide.
What is the SMILES notation for N-[2-(5,6-dihydro-4H-cyclopenta[c]thiophen-5-ylamino)-2-oxoethyl]-N-methylprop-2-enamide?
The canonical SMILES for N-[2-(5,6-dihydro-4H-cyclopenta[c]thiophen-5-ylamino)-2-oxoethyl]-N-methylprop-2-enamide is C=CC(=O)N(C)CC(=O)NC1Cc2cscc2C1.
What is the InChIKey of N-[2-(5,6-dihydro-4H-cyclopenta[c]thiophen-5-ylamino)-2-oxoethyl]-N-methylprop-2-enamide?
The InChIKey is NHBKNDAVESKMMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S/c1-3-13(17)15(2)6-12(16)14-11-4-9-7-18-8-10(9)5-11/h3,7-8,11H,1,4-6H2,2H3,(H,14,16).
What are the key properties of N-[2-(5,6-dihydro-4H-cyclopenta[c]thiophen-5-ylamino)-2-oxoethyl]-N-methylprop-2-enamide?
N-[2-(5,6-dihydro-4H-cyclopenta[c]thiophen-5-ylamino)-2-oxoethyl]-N-methylprop-2-enamide has a molecular weight of 264.35 g/mol, XLogP of 0.98, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5,6-dihydro-4H-cyclopenta[c]thiophen-5-ylamino)-2-oxoethyl]-N-methylprop-2-enamide is sourced from PubChem (CID 166416058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).