C21H21N3O2 — CID 166416080
N-methyl-N-[4-(spiro[2H-pyrrolo[3,2-b]pyridine-3,1'-cyclobutane]-1-carbonyl)phenyl]prop-2-enamide (PubChem CID 166416080) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-methyl-N-[4-(spiro[2H-pyrrolo[3,2-b]pyridine-3,1'-cyclobutane]-1-carbonyl)phenyl]prop-2-enamide.
| Compound Name | N-methyl-N-[4-(spiro[2H-pyrrolo[3,2-b]pyridine-3,1'-cyclobutane]-1-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166416080 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-methyl-N-[4-(spiro[2H-pyrrolo[3,2-b]pyridine-3,1'-cyclobutane]-1-carbonyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)c1ccc(C(=O)N2CC3(CCC3)c3ncccc32)cc1 |
| InChI | InChI=1S/C21H21N3O2/c1-3-18(25)23(2)16-9-7-15(8-10-16)20(26)24-14-21(11-5-12-21)19-17(24)6-4-13-22-19/h3-4,6-10,13H,1,5,11-12,14H2,2H3 |
| InChIKey | KXWWDDZPUZBGLV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|