C12H15FN2OS — CID 166417090
2-fluoro-N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)methyl]prop-2-enamide (PubChem CID 166417090) has the molecular formula C12H15FN2OS and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-fluoro-N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)methyl]prop-2-enamide.
| Compound Name | 2-fluoro-N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166417090 |
| Molecular Formula | C12H15FN2OS |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-fluoro-N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)methyl]prop-2-enamide |
| SMILES | C=C(F)C(=O)NCC1CCCc2sc(C)nc21 |
| InChI | InChI=1S/C12H15FN2OS/c1-7(13)12(16)14-6-9-4-3-5-10-11(9)15-8(2)17-10/h9H,1,3-6H2,2H3,(H,14,16) |
| InChIKey | JVMQDZAAHWSERL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|