C15H18FN5O2 — CID 166417392
2-fluoro-1-[2-[5-(1-methylpyrazol-4-yl)-1,2,4-oxadiazol-3-yl]azepan-1-yl]prop-2-en-1-one (PubChem CID 166417392) has the molecular formula C15H18FN5O2 and a molecular weight of 319.34 g/mol. Its IUPAC name is 2-fluoro-1-[2-[5-(1-methylpyrazol-4-yl)-1,2,4-oxadiazol-3-yl]azepan-1-yl]prop-2-en-1-one.
| Compound Name | 2-fluoro-1-[2-[5-(1-methylpyrazol-4-yl)-1,2,4-oxadiazol-3-yl]azepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166417392 |
| Molecular Formula | C15H18FN5O2 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-fluoro-1-[2-[5-(1-methylpyrazol-4-yl)-1,2,4-oxadiazol-3-yl]azepan-1-yl]prop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1CCCCCC1c1noc(-c2cnn(C)c2)n1 |
| InChI | InChI=1S/C15H18FN5O2/c1-10(16)15(22)21-7-5-3-4-6-12(21)13-18-14(23-19-13)11-8-17-20(2)9-11/h8-9,12H,1,3-7H2,2H3 |
| InChIKey | WGNVBIRSRHTAOB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|