C11H17FN4O — CID 166417426
N-[1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethyl]-2-fluoroprop-2-enamide (PubChem CID 166417426) has the molecular formula C11H17FN4O and a molecular weight of 240.28 g/mol. Its IUPAC name is N-[1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethyl]-2-fluoroprop-2-enamide.
| Compound Name | N-[1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethyl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 166417426 |
| Molecular Formula | C11H17FN4O |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N-[1-(3-butan-2-yl-1H-1,2,4-triazol-5-yl)ethyl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)NC(C)c1nc(C(C)CC)n[nH]1 |
| InChI | InChI=1S/C11H17FN4O/c1-5-6(2)9-14-10(16-15-9)8(4)13-11(17)7(3)12/h6,8H,3,5H2,1-2,4H3,(H,13,17)(H,14,15,16) |
| InChIKey | OZOPFLUZYCKRAM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|