C11H11FN2O2 — CID 166417494
1-(2-fluoroprop-2-enoyl)-2,3,4,7-tetrahydro-1,7-naphthyridin-8-one (PubChem CID 166417494) has the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. Its IUPAC name is 1-(2-fluoroprop-2-enoyl)-2,3,4,7-tetrahydro-1,7-naphthyridin-8-one.
| Compound Name | 1-(2-fluoroprop-2-enoyl)-2,3,4,7-tetrahydro-1,7-naphthyridin-8-one |
|---|---|
| PubChem CID | 166417494 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1-(2-fluoroprop-2-enoyl)-2,3,4,7-tetrahydro-1,7-naphthyridin-8-one |
| SMILES | C=C(F)C(=O)N1CCCc2cc[nH]c(=O)c21 |
| InChI | InChI=1S/C11H11FN2O2/c1-7(12)11(16)14-6-2-3-8-4-5-13-10(15)9(8)14/h4-5H,1-3,6H2,(H,13,15) |
| InChIKey | MZOLLXDYTINECI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|